C21H27N3O4 — CID 71849001
3-(3,5-dimethoxyanilino)-N-(2-methoxyphenyl)piperidine-1-carboxamide (PubChem CID 71849001) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-N-(2-methoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 3-(3,5-dimethoxyanilino)-N-(2-methoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71849001 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-N-(2-methoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1cc(NC2CCCN(C(=O)Nc3ccccc3OC)C2)cc(OC)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-26-17-11-16(12-18(13-17)27-2)22-15-7-6-10-24(14-15)21(25)23-19-8-4-5-9-20(19)28-3/h4-5,8-9,11-13,15,22H,6-7,10,14H2,1-3H3,(H,23,25) |
| InChIKey | LIRFCAZQJXBTTO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |