C22H29N3O3 — CID 45245331
N-(2,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)piperidine-1-carboxamide (PubChem CID 45245331) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)piperidine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 45245331 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(3,4-dimethylanilino)piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCC(Nc3ccc(C)c(C)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-15-7-8-17(12-16(15)2)23-18-6-5-11-25(14-18)22(26)24-20-10-9-19(27-3)13-21(20)28-4/h7-10,12-13,18,23H,5-6,11,14H2,1-4H3,(H,24,26) |
| InChIKey | VYLYKNQXMPSGSU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |