C20H24ClN3O3 — CID 96542823
(3R)-N-(2-chlorophenyl)-3-(3,5-dimethoxyanilino)piperidine-1-carboxamide (PubChem CID 96542823) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is (3R)-N-(2-chlorophenyl)-3-(3,5-dimethoxyanilino)piperidine-1-carboxamide.
| Compound Name | (3R)-N-(2-chlorophenyl)-3-(3,5-dimethoxyanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 96542823 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (3R)-N-(2-chlorophenyl)-3-(3,5-dimethoxyanilino)piperidine-1-carboxamide |
| SMILES | COc1cc(N[C@@H]2CCCN(C(=O)Nc3ccccc3Cl)C2)cc(OC)c1 |
| InChI | InChI=1S/C20H24ClN3O3/c1-26-16-10-15(11-17(12-16)27-2)22-14-6-5-9-24(13-14)20(25)23-19-8-4-3-7-18(19)21/h3-4,7-8,10-12,14,22H,5-6,9,13H2,1-2H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | ATOCLTAJKXIISK-CQSZACIVSA-N |
| XLogP | 4.47 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |