C17H27N3O3 — CID 120873076
3-amino-1-[3-(3,5-dimethoxyanilino)piperidin-1-yl]butan-1-one (PubChem CID 120873076) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-amino-1-[3-(3,5-dimethoxyanilino)piperidin-1-yl]butan-1-one.
| Compound Name | 3-amino-1-[3-(3,5-dimethoxyanilino)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 120873076 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-amino-1-[3-(3,5-dimethoxyanilino)piperidin-1-yl]butan-1-one |
| SMILES | COc1cc(NC2CCCN(C(=O)CC(C)N)C2)cc(OC)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-12(18)7-17(21)20-6-4-5-13(11-20)19-14-8-15(22-2)10-16(9-14)23-3/h8-10,12-13,19H,4-7,11,18H2,1-3H3 |
| InChIKey | ZEAYLULGDCEOLE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |