C16H24N2O3 — CID 51726355
2-(3,5-dimethoxyanilino)-1-[(3S)-3-methylpiperidin-1-yl]ethanone (PubChem CID 51726355) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-1-[(3S)-3-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-(3,5-dimethoxyanilino)-1-[(3S)-3-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 51726355 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-1-[(3S)-3-methylpiperidin-1-yl]ethanone |
| SMILES | COc1cc(NCC(=O)N2CCC[C@H](C)C2)cc(OC)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-5-4-6-18(11-12)16(19)10-17-13-7-14(20-2)9-15(8-13)21-3/h7-9,12,17H,4-6,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | ZHCNCYNNACDIPP-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |