C19H22N4O4 — CID 122257006
4-[1-[(2-methoxyphenyl)carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122257006) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[1-[(2-methoxyphenyl)carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-[(2-methoxyphenyl)carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122257006 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[1-[(2-methoxyphenyl)carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCCC(Oc2ccnc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C19H22N4O4/c1-26-17-7-3-2-6-15(17)22-19(25)23-10-4-5-14(12-23)27-13-8-9-21-16(11-13)18(20)24/h2-3,6-9,11,14H,4-5,10,12H2,1H3,(H2,20,24)(H,22,25) |
| InChIKey | GDKMRENMUAUULN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |