C19H19F3N4O3 — CID 122257031
4-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122257031) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122257031 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCCN(C(=O)Nc3ccc(C(F)(F)F)cc3)C2)ccn1 |
| InChI | InChI=1S/C19H19F3N4O3/c20-19(21,22)12-3-5-13(6-4-12)25-18(28)26-9-1-2-15(11-26)29-14-7-8-24-16(10-14)17(23)27/h3-8,10,15H,1-2,9,11H2,(H2,23,27)(H,25,28) |
| InChIKey | OKULSACTCIDZPN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |