C18H18F3N3O2 — CID 122255985
3-pyridin-4-yloxy-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 122255985) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 3-pyridin-4-yloxy-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 3-pyridin-4-yloxy-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122255985 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-pyridin-4-yloxy-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)13-3-5-14(6-4-13)23-17(25)24-11-1-2-16(12-24)26-15-7-9-22-10-8-15/h3-10,16H,1-2,11-12H2,(H,23,25) |
| InChIKey | JEYSGDHZPRQLBU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |