C14H14F6N2O — CID 51944575
(3R)-3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 51944575) has the molecular formula C14H14F6N2O and a molecular weight of 340.27 g/mol. Its IUPAC name is (3R)-3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51944575 |
| Molecular Formula | C14H14F6N2O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (3R)-3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14F6N2O/c15-13(16,17)9-3-5-11(6-4-9)21-12(23)22-7-1-2-10(8-22)14(18,19)20/h3-6,10H,1-2,7-8H2,(H,21,23)/t10-/m1/s1 |
| InChIKey | GULJAAVVEWXRGZ-SNVBAGLBSA-N |
| XLogP | 4.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |