C13H14F3N3O2 — CID 150068062
1-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 150068062) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 1-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 150068062 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O2/c14-13(15,16)8-3-5-9(6-4-8)18-12(21)19-7-1-2-10(19)11(17)20/h3-6,10H,1-2,7H2,(H2,17,20)(H,18,21) |
| InChIKey | DORQSONWBWATDJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |