C13H15F3N2O2 — CID 78942782
(2S)-2-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 78942782) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is (2S)-2-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 78942782 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2S)-2-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)9-3-5-10(6-4-9)17-12(20)18-7-1-2-11(18)8-19/h3-6,11,19H,1-2,7-8H2,(H,17,20)/t11-/m0/s1 |
| InChIKey | BGGPZWAKBGTOTI-NSHDSACASA-N |
| XLogP | 2.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |