C19H18F3NO2 — CID 67371292
[2-(hydroxymethyl)pyrrolidin-1-yl]-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 67371292) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 67371292 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)N1CCCC1CO |
| InChI | InChI=1S/C19H18F3NO2/c20-19(21,22)16-9-7-14(8-10-16)13-3-5-15(6-4-13)18(25)23-11-1-2-17(23)12-24/h3-10,17,24H,1-2,11-12H2 |
| InChIKey | SQCNCCRFOLYXET-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |