C14H16F3NO2S — CID 43421260
[2-(hydroxymethyl)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone (PubChem CID 43421260) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone.
| Compound Name | [2-(hydroxymethyl)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 43421260 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [2-(hydroxymethyl)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccc(SC(F)(F)F)cc1)N1CCCCC1CO |
| InChI | InChI=1S/C14H16F3NO2S/c15-14(16,17)21-12-6-4-10(5-7-12)13(20)18-8-2-1-3-11(18)9-19/h4-7,11,19H,1-3,8-9H2 |
| InChIKey | UKHOUGRPPRUIGJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |