C15H19F3N2O3S2 — CID 43073371
N-[[1-[4-(trifluoromethylsulfanyl)benzoyl]piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 43073371) has the molecular formula C15H19F3N2O3S2 and a molecular weight of 396.46 g/mol. Its IUPAC name is N-[[1-[4-(trifluoromethylsulfanyl)benzoyl]piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[4-(trifluoromethylsulfanyl)benzoyl]piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 43073371 |
| Molecular Formula | C15H19F3N2O3S2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[[1-[4-(trifluoromethylsulfanyl)benzoyl]piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O3S2/c1-25(22,23)19-10-12-4-2-3-9-20(12)14(21)11-5-7-13(8-6-11)24-15(16,17)18/h5-8,12,19H,2-4,9-10H2,1H3 |
| InChIKey | JMDOHPVSFPAVHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |