C14H22ClN3O3S — CID 119722457
N-[[1-(3-aminobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride (PubChem CID 119722457) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is N-[[1-(3-aminobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[[1-(3-aminobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119722457 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[[1-(3-aminobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1cccc(N)c1.Cl |
| InChI | InChI=1S/C14H21N3O3S.ClH/c1-21(19,20)16-10-13-7-2-3-8-17(13)14(18)11-5-4-6-12(15)9-11;/h4-6,9,13,16H,2-3,7-8,10,15H2,1H3;1H |
| InChIKey | SWHIBDXFUKZJHK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|