C14H21Cl2N3O3S — CID 119722447
N-[[1-(4-amino-2-chlorobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride (PubChem CID 119722447) has the molecular formula C14H21Cl2N3O3S and a molecular weight of 382.31 g/mol. Its IUPAC name is N-[[1-(4-amino-2-chlorobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[[1-(4-amino-2-chlorobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119722447 |
| Molecular Formula | C14H21Cl2N3O3S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[[1-(4-amino-2-chlorobenzoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1ccc(N)cc1Cl.Cl |
| InChI | InChI=1S/C14H20ClN3O3S.ClH/c1-22(20,21)17-9-11-4-2-3-7-18(11)14(19)12-6-5-10(16)8-13(12)15;/h5-6,8,11,17H,2-4,7,9,16H2,1H3;1H |
| InChIKey | DIRPLDZTRWWZPE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|