C13H20N4O3S — CID 104741635
N-[[1-(3-aminopyridine-2-carbonyl)piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 104741635) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[[1-(3-aminopyridine-2-carbonyl)piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(3-aminopyridine-2-carbonyl)piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 104741635 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[[1-(3-aminopyridine-2-carbonyl)piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1ncccc1N |
| InChI | InChI=1S/C13H20N4O3S/c1-21(19,20)16-9-10-5-2-3-8-17(10)13(18)12-11(14)6-4-7-15-12/h4,6-7,10,16H,2-3,5,8-9,14H2,1H3 |
| InChIKey | FBAWXVYEPUJLAT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |