C15H22N4O4S — CID 43073423
[4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]urea (PubChem CID 43073423) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is [4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]urea.
| Compound Name | [4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 43073423 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]urea |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H22N4O4S/c1-24(22,23)17-10-13-4-2-3-9-19(13)14(20)11-5-7-12(8-6-11)18-15(16)21/h5-8,13,17H,2-4,9-10H2,1H3,(H3,16,18,21) |
| InChIKey | JBTXZYDICQKTLQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |