C21H26N4O4S — CID 47029987
1-[4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]-3-phenylurea (PubChem CID 47029987) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 47029987 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[4-[2-(methanesulfonamidomethyl)piperidine-1-carbonyl]phenyl]-3-phenylurea |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-30(28,29)22-15-19-9-5-6-14-25(19)20(26)16-10-12-18(13-11-16)24-21(27)23-17-7-3-2-4-8-17/h2-4,7-8,10-13,19,22H,5-6,9,14-15H2,1H3,(H2,23,24,27) |
| InChIKey | SOBNMUUQFXUNJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |