C13H14ClF3N2O2 — CID 111104560
(2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 111104560) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111104560 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C13H14ClF3N2O2/c14-11-4-3-8(6-10(11)13(15,16)17)18-12(21)19-5-1-2-9(19)7-20/h3-4,6,9,20H,1-2,5,7H2,(H,18,21)/t9-/m0/s1 |
| InChIKey | SJLQGSQVOFFZOV-VIFPVBQESA-N |
| XLogP | 3.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |