C16H19ClF3N3O2 — CID 124568286
N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]oxamide (PubChem CID 124568286) has the molecular formula C16H19ClF3N3O2 and a molecular weight of 377.79 g/mol. Its IUPAC name is N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]oxamide.
| Compound Name | N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 124568286 |
| Molecular Formula | C16H19ClF3N3O2 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]oxamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19ClF3N3O2/c1-2-23-7-3-4-11(23)9-21-14(24)15(25)22-10-5-6-13(17)12(8-10)16(18,19)20/h5-6,8,11H,2-4,7,9H2,1H3,(H,21,24)(H,22,25)/t11-/m1/s1 |
| InChIKey | PZCJSJAMALAIBG-LLVKDONJSA-N |
| XLogP | 2.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|