C15H19F3N4O2 — CID 51971203
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide (PubChem CID 51971203) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
|---|---|
| PubChem CID | 51971203 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)C(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H19F3N4O2/c1-2-22-7-3-4-11(22)9-20-13(23)14(24)21-10-5-6-12(19-8-10)15(16,17)18/h5-6,8,11H,2-4,7,9H2,1H3,(H,20,23)(H,21,24)/t11-/m0/s1 |
| InChIKey | ZIYOSXIOMUBTIC-NSHDSACASA-N |
| XLogP | 1.64 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|