C17H27N5S — CID 42943839
1-[(1-ethylpyrrolidin-2-yl)methyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)thiourea (PubChem CID 42943839) has the molecular formula C17H27N5S and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)thiourea.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 42943839 |
| Molecular Formula | C17H27N5S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)thiourea |
| SMILES | CCN1CCCC1CNC(=S)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C17H27N5S/c1-2-21-11-5-6-15(21)13-19-17(23)20-14-7-8-16(18-12-14)22-9-3-4-10-22/h7-8,12,15H,2-6,9-11,13H2,1H3,(H2,19,20,23) |
| InChIKey | ADFVDLLMVAUPJE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|