C18H29N3S — CID 18283423
1-(4-butylphenyl)-3-[(1-ethylpyrrolidin-2-yl)methyl]thiourea (PubChem CID 18283423) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(1-ethylpyrrolidin-2-yl)methyl]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(1-ethylpyrrolidin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 18283423 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(1-ethylpyrrolidin-2-yl)methyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NCC2CCCN2CC)cc1 |
| InChI | InChI=1S/C18H29N3S/c1-3-5-7-15-9-11-16(12-10-15)20-18(22)19-14-17-8-6-13-21(17)4-2/h9-12,17H,3-8,13-14H2,1-2H3,(H2,19,20,22) |
| InChIKey | OYXBBJFZVIRYGN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|