C18H23N3S — CID 71903120
1-[(1-ethylpyrrolidin-2-yl)methyl]-3-naphthalen-1-ylthiourea (PubChem CID 71903120) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 71903120 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-naphthalen-1-ylthiourea |
| SMILES | CCN1CCCC1CNC(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H23N3S/c1-2-21-12-6-9-15(21)13-19-18(22)20-17-11-5-8-14-7-3-4-10-16(14)17/h3-5,7-8,10-11,15H,2,6,9,12-13H2,1H3,(H2,19,20,22) |
| InChIKey | LIVXXRDCVOXLJO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|