C15H23N3S — CID 2408802
1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(3-methylphenyl)thiourea (PubChem CID 2408802) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 2408802 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(3-methylphenyl)thiourea |
| SMILES | CCN1CCC[C@@H]1CNC(=S)Nc1cccc(C)c1 |
| InChI | InChI=1S/C15H23N3S/c1-3-18-9-5-8-14(18)11-16-15(19)17-13-7-4-6-12(2)10-13/h4,6-7,10,14H,3,5,8-9,11H2,1-2H3,(H2,16,17,19)/t14-/m1/s1 |
| InChIKey | XPYXYWOAXWTHEN-CQSZACIVSA-N |
| XLogP | 2.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|