C16H19F6N3S — CID 7177162
1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea (PubChem CID 7177162) has the molecular formula C16H19F6N3S and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 7177162 |
| Molecular Formula | C16H19F6N3S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
| SMILES | CCN1CCC[C@@H]1CNC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6N3S/c1-2-25-5-3-4-13(25)9-23-14(26)24-12-7-10(15(17,18)19)6-11(8-12)16(20,21)22/h6-8,13H,2-5,9H2,1H3,(H2,23,24,26)/t13-/m1/s1 |
| InChIKey | OSCQHJGENKSIMD-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|