C15H17F6N3S — CID 11991143
1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]thiourea (PubChem CID 11991143) has the molecular formula C15H17F6N3S and a molecular weight of 385.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 11991143 |
| Molecular Formula | C15H17F6N3S |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]thiourea |
| SMILES | CN1CCC[C@H]1CNC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F6N3S/c1-24-4-2-3-12(24)8-22-13(25)23-11-6-9(14(16,17)18)5-10(7-11)15(19,20)21/h5-7,12H,2-4,8H2,1H3,(H2,22,23,25)/t12-/m0/s1 |
| InChIKey | XYOJFUMQSZXIJL-LBPRGKRZSA-N |
| XLogP | 4.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|