C33H27F18N7S3 — CID 56590537
1-[2-[bis[2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]ethyl]amino]ethyl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea (PubChem CID 56590537) has the molecular formula C33H27F18N7S3 and a molecular weight of 959.79 g/mol. Its IUPAC name is 1-[2-[bis[2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]ethyl]amino]ethyl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[2-[bis[2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]ethyl]amino]ethyl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 56590537 |
| Molecular Formula | C33H27F18N7S3 |
| Molecular Weight | 959.79 g/mol |
| Exact Mass | 959.12 |
| IUPAC Name | 1-[2-[bis[2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]ethyl]amino]ethyl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)NCCN(CCNC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCNC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H27F18N7S3/c34-28(35,36)16-7-17(29(37,38)39)11-22(10-16)55-25(59)52-1-4-58(5-2-53-26(60)56-23-12-18(30(40,41)42)8-19(13-23)31(43,44)45)6-3-54-27(61)57-24-14-20(32(46,47)48)9-21(15-24)33(49,50)51/h7-15H,1-6H2,(H2,52,55,59)(H2,53,56,60)(H2,54,57,61) |
| InChIKey | YLNLOUZDBCHYKQ-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.79 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|