C15H18F6N2O2S — CID 127097937
1-[3,5-bis(trifluoromethyl)phenyl]-3-(2,2-diethoxyethyl)thiourea (PubChem CID 127097937) has the molecular formula C15H18F6N2O2S and a molecular weight of 404.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(2,2-diethoxyethyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(2,2-diethoxyethyl)thiourea |
|---|---|
| PubChem CID | 127097937 |
| Molecular Formula | C15H18F6N2O2S |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(2,2-diethoxyethyl)thiourea |
| SMILES | CCOC(CNC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OCC |
| InChI | InChI=1S/C15H18F6N2O2S/c1-3-24-12(25-4-2)8-22-13(26)23-11-6-9(14(16,17)18)5-10(7-11)15(19,20)21/h5-7,12H,3-4,8H2,1-2H3,(H2,22,23,26) |
| InChIKey | XWDPZMFFSKUFHX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|