C14H23N3O4S — CID 10592468
1-(2,2-diethoxyethyl)-3-(4,5-dimethoxy-2-pyridinyl)thiourea (PubChem CID 10592468) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-(4,5-dimethoxy-2-pyridinyl)thiourea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-(4,5-dimethoxy-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 10592468 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-(4,5-dimethoxy-2-pyridinyl)thiourea |
| SMILES | CCOC(CNC(=S)Nc1cc(OC)c(OC)cn1)OCC |
| InChI | InChI=1S/C14H23N3O4S/c1-5-20-13(21-6-2)9-16-14(22)17-12-7-10(18-3)11(19-4)8-15-12/h7-8,13H,5-6,9H2,1-4H3,(H2,15,16,17,22) |
| InChIKey | UTEIFAUDRRESEL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|