C15H24O5 — CID 104928930
(1R)-1-[4-(2,2-diethoxyethoxy)-3-methoxyphenyl]ethanol (PubChem CID 104928930) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R)-1-[4-(2,2-diethoxyethoxy)-3-methoxyphenyl]ethanol.
| Compound Name | (1R)-1-[4-(2,2-diethoxyethoxy)-3-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 104928930 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R)-1-[4-(2,2-diethoxyethoxy)-3-methoxyphenyl]ethanol |
| SMILES | CCOC(COc1ccc([C@@H](C)O)cc1OC)OCC |
| InChI | InChI=1S/C15H24O5/c1-5-18-15(19-6-2)10-20-13-8-7-12(11(3)16)9-14(13)17-4/h7-9,11,15-16H,5-6,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | CSISACSKDPRDSN-LLVKDONJSA-N |
| XLogP | 2.53 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|