C12H18O5 — CID 82851067
3-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]propane-1,2-diol (PubChem CID 82851067) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82851067 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]propane-1,2-diol |
| SMILES | COc1cc([C@H](C)O)ccc1OCC(O)CO |
| InChI | InChI=1S/C12H18O5/c1-8(14)9-3-4-11(12(5-9)16-2)17-7-10(15)6-13/h3-5,8,10,13-15H,6-7H2,1-2H3/t8-,10?/m0/s1 |
| InChIKey | VHTFKLTZHHFQOE-PEHGTWAWSA-N |
| XLogP | 0.48 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |