C13H20N2O5 — CID 108895659
1-(2,2-diethoxyethyl)-3-(3,5-dihydroxyphenyl)urea (PubChem CID 108895659) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-(3,5-dihydroxyphenyl)urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-(3,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108895659 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-(3,5-dihydroxyphenyl)urea |
| SMILES | CCOC(CNC(=O)Nc1cc(O)cc(O)c1)OCC |
| InChI | InChI=1S/C13H20N2O5/c1-3-19-12(20-4-2)8-14-13(18)15-9-5-10(16)7-11(17)6-9/h5-7,12,16-17H,3-4,8H2,1-2H3,(H2,14,15,18) |
| InChIKey | ZKIJKSIIYHEMRM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|