C15H21N5O3 — CID 10519663
1-(2,2-diethoxyethyl)-3-[4-(triazol-1-yl)phenyl]urea (PubChem CID 10519663) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-[4-(triazol-1-yl)phenyl]urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-[4-(triazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 10519663 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-[4-(triazol-1-yl)phenyl]urea |
| SMILES | CCOC(CNC(=O)Nc1ccc(-n2ccnn2)cc1)OCC |
| InChI | InChI=1S/C15H21N5O3/c1-3-22-14(23-4-2)11-16-15(21)18-12-5-7-13(8-6-12)20-10-9-17-19-20/h5-10,14H,3-4,11H2,1-2H3,(H2,16,18,21) |
| InChIKey | CLTOWDAFKXYPCI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|