C13H20N2O4 — CID 3823271
1-(2,2-dimethoxyethyl)-3-(4-ethoxyphenyl)urea (PubChem CID 3823271) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 3823271 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCC(OC)OC)cc1 |
| InChI | InChI=1S/C13H20N2O4/c1-4-19-11-7-5-10(6-8-11)15-13(16)14-9-12(17-2)18-3/h5-8,12H,4,9H2,1-3H3,(H2,14,15,16) |
| InChIKey | NUPKXWZKOCGVHQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|