C9H11ClN2O3 — CID 108895408
1-(2-chloroethyl)-3-(3,5-dihydroxyphenyl)urea (PubChem CID 108895408) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(3,5-dihydroxyphenyl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(3,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108895408 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-(2-chloroethyl)-3-(3,5-dihydroxyphenyl)urea |
| SMILES | O=C(NCCCl)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H11ClN2O3/c10-1-2-11-9(15)12-6-3-7(13)5-8(14)4-6/h3-5,13-14H,1-2H2,(H2,11,12,15) |
| InChIKey | PSILNFWYXAWGDN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|