C11H14N2O5 — CID 108895385
4-[(3,5-dihydroxyphenyl)carbamoylamino]butanoic acid (PubChem CID 108895385) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 4-[(3,5-dihydroxyphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(3,5-dihydroxyphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 108895385 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-[(3,5-dihydroxyphenyl)carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14N2O5/c14-8-4-7(5-9(15)6-8)13-11(18)12-3-1-2-10(16)17/h4-6,14-15H,1-3H2,(H,16,17)(H2,12,13,18) |
| InChIKey | RSDVSJBWEOAMCX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|