C15H20F2N2O4 — CID 122089327
4-[[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]carbamoylamino]butanoic acid (PubChem CID 122089327) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-[[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122089327 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-[[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]carbamoylamino]butanoic acid |
| SMILES | CC(C)(C)Oc1c(F)cc(NC(=O)NCCCC(=O)O)cc1F |
| InChI | InChI=1S/C15H20F2N2O4/c1-15(2,3)23-13-10(16)7-9(8-11(13)17)19-14(22)18-6-4-5-12(20)21/h7-8H,4-6H2,1-3H3,(H,20,21)(H2,18,19,22) |
| InChIKey | JVKARJZIRVENDU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|