C13H14F2N2O5 — CID 122076172
4-[(2,4-difluoro-5-methoxycarbonylphenyl)carbamoylamino]butanoic acid (PubChem CID 122076172) has the molecular formula C13H14F2N2O5 and a molecular weight of 316.26 g/mol. Its IUPAC name is 4-[(2,4-difluoro-5-methoxycarbonylphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2,4-difluoro-5-methoxycarbonylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122076172 |
| Molecular Formula | C13H14F2N2O5 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[(2,4-difluoro-5-methoxycarbonylphenyl)carbamoylamino]butanoic acid |
| SMILES | COC(=O)c1cc(NC(=O)NCCCC(=O)O)c(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O5/c1-22-12(20)7-5-10(9(15)6-8(7)14)17-13(21)16-4-2-3-11(18)19/h5-6H,2-4H2,1H3,(H,18,19)(H2,16,17,21) |
| InChIKey | YJJWPBNDCZWGIC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|