C14H16F2N2O5 — CID 122087937
4-[(2-ethoxycarbonyl-4,5-difluorophenyl)carbamoylamino]butanoic acid (PubChem CID 122087937) has the molecular formula C14H16F2N2O5 and a molecular weight of 330.29 g/mol. Its IUPAC name is 4-[(2-ethoxycarbonyl-4,5-difluorophenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2-ethoxycarbonyl-4,5-difluorophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122087937 |
| Molecular Formula | C14H16F2N2O5 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[(2-ethoxycarbonyl-4,5-difluorophenyl)carbamoylamino]butanoic acid |
| SMILES | CCOC(=O)c1cc(F)c(F)cc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H16F2N2O5/c1-2-23-13(21)8-6-9(15)10(16)7-11(8)18-14(22)17-5-3-4-12(19)20/h6-7H,2-5H2,1H3,(H,19,20)(H2,17,18,22) |
| InChIKey | ZGWIDXCKFSRQSZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|