C12H15F2N3O3 — CID 62866801
2-[2-(dimethylamino)ethylcarbamoylamino]-4,5-difluorobenzoic acid (PubChem CID 62866801) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylcarbamoylamino]-4,5-difluorobenzoic acid.
| Compound Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 62866801 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-4,5-difluorobenzoic acid |
| SMILES | CN(C)CCNC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C12H15F2N3O3/c1-17(2)4-3-15-12(20)16-10-6-9(14)8(13)5-7(10)11(18)19/h5-6H,3-4H2,1-2H3,(H,18,19)(H2,15,16,20) |
| InChIKey | GCUDBSANMYLSSH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |