C13H12F2N2O3S — CID 106431240
4,5-difluoro-2-(2-prop-2-ynylsulfanylethylcarbamoylamino)benzoic acid (PubChem CID 106431240) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is 4,5-difluoro-2-(2-prop-2-ynylsulfanylethylcarbamoylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(2-prop-2-ynylsulfanylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106431240 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4,5-difluoro-2-(2-prop-2-ynylsulfanylethylcarbamoylamino)benzoic acid |
| SMILES | C#CCSCCNC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C13H12F2N2O3S/c1-2-4-21-5-3-16-13(20)17-11-7-10(15)9(14)6-8(11)12(18)19/h1,6-7H,3-5H2,(H,18,19)(H2,16,17,20) |
| InChIKey | RGBAVMPELSPSHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|