C10H9F2NO3S — CID 62865365
4,5-difluoro-2-[(2-methylsulfanylacetyl)amino]benzoic acid (PubChem CID 62865365) has the molecular formula C10H9F2NO3S and a molecular weight of 261.25 g/mol. Its IUPAC name is 4,5-difluoro-2-[(2-methylsulfanylacetyl)amino]benzoic acid.
| Compound Name | 4,5-difluoro-2-[(2-methylsulfanylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62865365 |
| Molecular Formula | C10H9F2NO3S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 4,5-difluoro-2-[(2-methylsulfanylacetyl)amino]benzoic acid |
| SMILES | CSCC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C10H9F2NO3S/c1-17-4-9(14)13-8-3-7(12)6(11)2-5(8)10(15)16/h2-3H,4H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | JVPVTQCPOHPQFM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |