C12H14F2N2O3 — CID 64679134
2-[(3-amino-3-methylbutanoyl)amino]-4,5-difluorobenzoic acid (PubChem CID 64679134) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-[(3-amino-3-methylbutanoyl)amino]-4,5-difluorobenzoic acid.
| Compound Name | 2-[(3-amino-3-methylbutanoyl)amino]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 64679134 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[(3-amino-3-methylbutanoyl)amino]-4,5-difluorobenzoic acid |
| SMILES | CC(C)(N)CC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C12H14F2N2O3/c1-12(2,15)5-10(17)16-9-4-8(14)7(13)3-6(9)11(18)19/h3-4H,5,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | NNMSOOXLBZPKCD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |