C14H18F2N2O3 — CID 62866446
4,5-difluoro-2-[4-(propan-2-ylamino)butanoylamino]benzoic acid (PubChem CID 62866446) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4,5-difluoro-2-[4-(propan-2-ylamino)butanoylamino]benzoic acid.
| Compound Name | 4,5-difluoro-2-[4-(propan-2-ylamino)butanoylamino]benzoic acid |
|---|---|
| PubChem CID | 62866446 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,5-difluoro-2-[4-(propan-2-ylamino)butanoylamino]benzoic acid |
| SMILES | CC(C)NCCCC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C14H18F2N2O3/c1-8(2)17-5-3-4-13(19)18-12-7-11(16)10(15)6-9(12)14(20)21/h6-8,17H,3-5H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | CDIKAZJHOKRQME-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|