C15H22F2N2O — CID 60850443
N-[1-(3,4-difluorophenyl)ethyl]-4-(propan-2-ylamino)butanamide (PubChem CID 60850443) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-4-(propan-2-ylamino)butanamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 60850443 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-4-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NCCCC(=O)NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-10(2)18-8-4-5-15(20)19-11(3)12-6-7-13(16)14(17)9-12/h6-7,9-11,18H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | GAXGBYZZYQUSGF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|