C18H19F2N3O3 — CID 51211735
N-[1-(3,4-difluorophenyl)ethyl]-4-(4-nitroanilino)butanamide (PubChem CID 51211735) has the molecular formula C18H19F2N3O3 and a molecular weight of 363.36 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-4-(4-nitroanilino)butanamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-4-(4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 51211735 |
| Molecular Formula | C18H19F2N3O3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-4-(4-nitroanilino)butanamide |
| SMILES | CC(NC(=O)CCCNc1ccc([N+](=O)[O-])cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H19F2N3O3/c1-12(13-4-9-16(19)17(20)11-13)22-18(24)3-2-10-21-14-5-7-15(8-6-14)23(25)26/h4-9,11-12,21H,2-3,10H2,1H3,(H,22,24) |
| InChIKey | YSYXAGYFRRWZJX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|