C18H25F2N3O2 — CID 18146670
3-(cyclohexylcarbamoylamino)-N-[1-(3,4-difluorophenyl)ethyl]propanamide (PubChem CID 18146670) has the molecular formula C18H25F2N3O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is 3-(cyclohexylcarbamoylamino)-N-[1-(3,4-difluorophenyl)ethyl]propanamide.
| Compound Name | 3-(cyclohexylcarbamoylamino)-N-[1-(3,4-difluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 18146670 |
| Molecular Formula | C18H25F2N3O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-(cyclohexylcarbamoylamino)-N-[1-(3,4-difluorophenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCNC(=O)NC1CCCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H25F2N3O2/c1-12(13-7-8-15(19)16(20)11-13)22-17(24)9-10-21-18(25)23-14-5-3-2-4-6-14/h7-8,11-12,14H,2-6,9-10H2,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | HIJLQGGYVIRNBM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |