C20H21F2NO3 — CID 78778582
4-(4-acetylphenoxy)-N-[1-(3,4-difluorophenyl)ethyl]butanamide (PubChem CID 78778582) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[1-(3,4-difluorophenyl)ethyl]butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[1-(3,4-difluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 78778582 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[1-(3,4-difluorophenyl)ethyl]butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)NC(C)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H21F2NO3/c1-13(16-7-10-18(21)19(22)12-16)23-20(25)4-3-11-26-17-8-5-15(6-9-17)14(2)24/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,25) |
| InChIKey | XGOCUJVKGHGRKR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|